C12H25N3O3S — CID 79937523
N-(3-hydroxypropyl)-N,3-dimethyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-sulfonamide (PubChem CID 79937523) has the molecular formula C12H25N3O3S and a molecular weight of 291.42 g/mol. Its IUPAC name is N-(3-hydroxypropyl)-N,3-dimethyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-sulfonamide.
| Compound Name | N-(3-hydroxypropyl)-N,3-dimethyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-sulfonamide |
|---|---|
| PubChem CID | 79937523 |
| Molecular Formula | C12H25N3O3S |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | N-(3-hydroxypropyl)-N,3-dimethyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-sulfonamide |
| SMILES | CC1CN2CCCC2CN1S(=O)(=O)N(C)CCCO |
| InChI | InChI=1S/C12H25N3O3S/c1-11-9-14-7-3-5-12(14)10-15(11)19(17,18)13(2)6-4-8-16/h11-12,16H,3-10H2,1-2H3 |
| InChIKey | SYXMFMQNFUWBLV-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |