C14H29N3O3S — CID 102971424
N-[3-(cyclopropylamino)propyl]-3-methoxy-N,4-dimethylpiperidine-1-sulfonamide (PubChem CID 102971424) has the molecular formula C14H29N3O3S and a molecular weight of 319.47 g/mol. Its IUPAC name is N-[3-(cyclopropylamino)propyl]-3-methoxy-N,4-dimethylpiperidine-1-sulfonamide.
| Compound Name | N-[3-(cyclopropylamino)propyl]-3-methoxy-N,4-dimethylpiperidine-1-sulfonamide |
|---|---|
| PubChem CID | 102971424 |
| Molecular Formula | C14H29N3O3S |
| Molecular Weight | 319.47 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | N-[3-(cyclopropylamino)propyl]-3-methoxy-N,4-dimethylpiperidine-1-sulfonamide |
| SMILES | COC1CN(S(=O)(=O)N(C)CCCNC2CC2)CCC1C |
| InChI | InChI=1S/C14H29N3O3S/c1-12-7-10-17(11-14(12)20-3)21(18,19)16(2)9-4-8-15-13-5-6-13/h12-15H,4-11H2,1-3H3 |
| InChIKey | WKJXOSZHLVYUIR-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.47 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|