C14H31N3O3S — CID 102971673
3-methoxy-N,4-dimethyl-N-[3-(propan-2-ylamino)propyl]piperidine-1-sulfonamide (PubChem CID 102971673) has the molecular formula C14H31N3O3S and a molecular weight of 321.49 g/mol. Its IUPAC name is 3-methoxy-N,4-dimethyl-N-[3-(propan-2-ylamino)propyl]piperidine-1-sulfonamide.
| Compound Name | 3-methoxy-N,4-dimethyl-N-[3-(propan-2-ylamino)propyl]piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 102971673 |
| Molecular Formula | C14H31N3O3S |
| Molecular Weight | 321.49 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | 3-methoxy-N,4-dimethyl-N-[3-(propan-2-ylamino)propyl]piperidine-1-sulfonamide |
| SMILES | COC1CN(S(=O)(=O)N(C)CCCNC(C)C)CCC1C |
| InChI | InChI=1S/C14H31N3O3S/c1-12(2)15-8-6-9-16(4)21(18,19)17-10-7-13(3)14(11-17)20-5/h12-15H,6-11H2,1-5H3 |
| InChIKey | PSKFSWBMCLMWSM-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.49 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|