C14H34N4O2S — CID 106095094
1-[methyl-[3-[methyl(propan-2-yl)amino]propylsulfamoyl]amino]-3-(propan-2-ylamino)propane (PubChem CID 106095094) has the molecular formula C14H34N4O2S and a molecular weight of 322.52 g/mol. Its IUPAC name is 1-[methyl-[3-[methyl(propan-2-yl)amino]propylsulfamoyl]amino]-3-(propan-2-ylamino)propane.
| Compound Name | 1-[methyl-[3-[methyl(propan-2-yl)amino]propylsulfamoyl]amino]-3-(propan-2-ylamino)propane |
|---|---|
| PubChem CID | 106095094 |
| Molecular Formula | C14H34N4O2S |
| Molecular Weight | 322.52 g/mol |
| Exact Mass | 322.24 |
| IUPAC Name | 1-[methyl-[3-[methyl(propan-2-yl)amino]propylsulfamoyl]amino]-3-(propan-2-ylamino)propane |
| SMILES | CC(C)NCCCN(C)S(=O)(=O)NCCCN(C)C(C)C |
| InChI | InChI=1S/C14H34N4O2S/c1-13(2)15-9-7-12-18(6)21(19,20)16-10-8-11-17(5)14(3)4/h13-16H,7-12H2,1-6H3 |
| InChIKey | QRTFHVRFGXJZNI-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.52 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|