C13H31N3O3S — CID 106085328
2-methyl-1-[2-[[methyl-[3-(propan-2-ylamino)propyl]sulfamoyl]amino]ethoxy]propane (PubChem CID 106085328) has the molecular formula C13H31N3O3S and a molecular weight of 309.48 g/mol. Its IUPAC name is 2-methyl-1-[2-[[methyl-[3-(propan-2-ylamino)propyl]sulfamoyl]amino]ethoxy]propane.
| Compound Name | 2-methyl-1-[2-[[methyl-[3-(propan-2-ylamino)propyl]sulfamoyl]amino]ethoxy]propane |
|---|---|
| PubChem CID | 106085328 |
| Molecular Formula | C13H31N3O3S |
| Molecular Weight | 309.48 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | 2-methyl-1-[2-[[methyl-[3-(propan-2-ylamino)propyl]sulfamoyl]amino]ethoxy]propane |
| SMILES | CC(C)COCCNS(=O)(=O)N(C)CCCNC(C)C |
| InChI | InChI=1S/C13H31N3O3S/c1-12(2)11-19-10-8-15-20(17,18)16(5)9-6-7-14-13(3)4/h12-15H,6-11H2,1-5H3 |
| InChIKey | WUVIQPQHAJLNBU-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.48 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|