C12H26N6O2S — CID 106077012
1-[3-[[methyl-[3-(propan-2-ylamino)propyl]sulfamoyl]amino]propyl]triazole (PubChem CID 106077012) has the molecular formula C12H26N6O2S and a molecular weight of 318.45 g/mol. Its IUPAC name is 1-[3-[[methyl-[3-(propan-2-ylamino)propyl]sulfamoyl]amino]propyl]triazole.
| Compound Name | 1-[3-[[methyl-[3-(propan-2-ylamino)propyl]sulfamoyl]amino]propyl]triazole |
|---|---|
| PubChem CID | 106077012 |
| Molecular Formula | C12H26N6O2S |
| Molecular Weight | 318.45 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | 1-[3-[[methyl-[3-(propan-2-ylamino)propyl]sulfamoyl]amino]propyl]triazole |
| SMILES | CC(C)NCCCN(C)S(=O)(=O)NCCCn1ccnn1 |
| InChI | InChI=1S/C12H26N6O2S/c1-12(2)13-6-4-9-17(3)21(19,20)15-7-5-10-18-11-8-14-16-18/h8,11-13,15H,4-7,9-10H2,1-3H3 |
| InChIKey | LSYITMNTEFMABA-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.45 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|