C11H24N6O2S — CID 106077211
1-[2-[[methyl-[3-(propylamino)propyl]sulfamoyl]amino]ethyl]triazole (PubChem CID 106077211) has the molecular formula C11H24N6O2S and a molecular weight of 304.42 g/mol. Its IUPAC name is 1-[2-[[methyl-[3-(propylamino)propyl]sulfamoyl]amino]ethyl]triazole.
| Compound Name | 1-[2-[[methyl-[3-(propylamino)propyl]sulfamoyl]amino]ethyl]triazole |
|---|---|
| PubChem CID | 106077211 |
| Molecular Formula | C11H24N6O2S |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | 1-[2-[[methyl-[3-(propylamino)propyl]sulfamoyl]amino]ethyl]triazole |
| SMILES | CCCNCCCN(C)S(=O)(=O)NCCn1ccnn1 |
| InChI | InChI=1S/C11H24N6O2S/c1-3-5-12-6-4-9-16(2)20(18,19)14-8-11-17-10-7-13-15-17/h7,10,12,14H,3-6,8-9,11H2,1-2H3 |
| InChIKey | RSCCBOZDBVRVON-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|