C11H23N5O2S — CID 106085278
2-[2-[[3-(ethylamino)propyl-methylsulfamoyl]amino]ethyl]-1H-imidazole (PubChem CID 106085278) has the molecular formula C11H23N5O2S and a molecular weight of 289.40 g/mol. Its IUPAC name is 2-[2-[[3-(ethylamino)propyl-methylsulfamoyl]amino]ethyl]-1H-imidazole.
| Compound Name | 2-[2-[[3-(ethylamino)propyl-methylsulfamoyl]amino]ethyl]-1H-imidazole |
|---|---|
| PubChem CID | 106085278 |
| Molecular Formula | C11H23N5O2S |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | 2-[2-[[3-(ethylamino)propyl-methylsulfamoyl]amino]ethyl]-1H-imidazole |
| SMILES | CCNCCCN(C)S(=O)(=O)NCCc1ncc[nH]1 |
| InChI | InChI=1S/C11H23N5O2S/c1-3-12-6-4-10-16(2)19(17,18)15-7-5-11-13-8-9-14-11/h8-9,12,15H,3-7,10H2,1-2H3,(H,13,14) |
| InChIKey | OUYVYFGPKQGXTC-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|