C10H21N5O3S — CID 106411298
3-[2-[[3-(ethylamino)propyl-methylsulfamoyl]amino]ethyl]-1,2,4-oxadiazole (PubChem CID 106411298) has the molecular formula C10H21N5O3S and a molecular weight of 291.38 g/mol. Its IUPAC name is 3-[2-[[3-(ethylamino)propyl-methylsulfamoyl]amino]ethyl]-1,2,4-oxadiazole.
| Compound Name | 3-[2-[[3-(ethylamino)propyl-methylsulfamoyl]amino]ethyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 106411298 |
| Molecular Formula | C10H21N5O3S |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 3-[2-[[3-(ethylamino)propyl-methylsulfamoyl]amino]ethyl]-1,2,4-oxadiazole |
| SMILES | CCNCCCN(C)S(=O)(=O)NCCc1ncon1 |
| InChI | InChI=1S/C10H21N5O3S/c1-3-11-6-4-8-15(2)19(16,17)13-7-5-10-12-9-18-14-10/h9,11,13H,3-8H2,1-2H3 |
| InChIKey | PPENIVBBDBJWBI-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 100.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|