C11H23N5O2S — CID 106018170
1-[2-[[3-(ethylamino)propyl-methylsulfamoyl]amino]ethyl]imidazole (PubChem CID 106018170) has the molecular formula C11H23N5O2S and a molecular weight of 289.40 g/mol. Its IUPAC name is 1-[2-[[3-(ethylamino)propyl-methylsulfamoyl]amino]ethyl]imidazole.
| Compound Name | 1-[2-[[3-(ethylamino)propyl-methylsulfamoyl]amino]ethyl]imidazole |
|---|---|
| PubChem CID | 106018170 |
| Molecular Formula | C11H23N5O2S |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | 1-[2-[[3-(ethylamino)propyl-methylsulfamoyl]amino]ethyl]imidazole |
| SMILES | CCNCCCN(C)S(=O)(=O)NCCn1ccnc1 |
| InChI | InChI=1S/C11H23N5O2S/c1-3-12-5-4-8-15(2)19(17,18)14-7-10-16-9-6-13-11-16/h6,9,11-12,14H,3-5,7-8,10H2,1-2H3 |
| InChIKey | IXYKSBIATZNUMP-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|