C12H25N5O2S — CID 106010320
1-[2-[[3-(ethylamino)propyl-methylsulfamoyl]amino]propyl]imidazole (PubChem CID 106010320) has the molecular formula C12H25N5O2S and a molecular weight of 303.43 g/mol. Its IUPAC name is 1-[2-[[3-(ethylamino)propyl-methylsulfamoyl]amino]propyl]imidazole.
| Compound Name | 1-[2-[[3-(ethylamino)propyl-methylsulfamoyl]amino]propyl]imidazole |
|---|---|
| PubChem CID | 106010320 |
| Molecular Formula | C12H25N5O2S |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | 1-[2-[[3-(ethylamino)propyl-methylsulfamoyl]amino]propyl]imidazole |
| SMILES | CCNCCCN(C)S(=O)(=O)NC(C)Cn1ccnc1 |
| InChI | InChI=1S/C12H25N5O2S/c1-4-13-6-5-8-16(3)20(18,19)15-12(2)10-17-9-7-14-11-17/h7,9,11-13,15H,4-6,8,10H2,1-3H3 |
| InChIKey | KSINDOQBZKWTBB-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|