C9H20N6O2S — CID 106077188
1-[2-[[methyl-[3-(methylamino)propyl]sulfamoyl]amino]ethyl]triazole (PubChem CID 106077188) has the molecular formula C9H20N6O2S and a molecular weight of 276.37 g/mol. Its IUPAC name is 1-[2-[[methyl-[3-(methylamino)propyl]sulfamoyl]amino]ethyl]triazole.
| Compound Name | 1-[2-[[methyl-[3-(methylamino)propyl]sulfamoyl]amino]ethyl]triazole |
|---|---|
| PubChem CID | 106077188 |
| Molecular Formula | C9H20N6O2S |
| Molecular Weight | 276.37 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 1-[2-[[methyl-[3-(methylamino)propyl]sulfamoyl]amino]ethyl]triazole |
| SMILES | CNCCCN(C)S(=O)(=O)NCCn1ccnn1 |
| InChI | InChI=1S/C9H20N6O2S/c1-10-4-3-7-14(2)18(16,17)12-6-9-15-8-5-11-13-15/h5,8,10,12H,3-4,6-7,9H2,1-2H3 |
| InChIKey | KDTDBZFHBRVZDY-UHFFFAOYSA-N |
| XLogP | -1.35 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.37 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|