C13H32N4O2S — CID 106041029
1-[2-[di(propan-2-yl)amino]ethylsulfamoyl-methylamino]-3-(methylamino)propane (PubChem CID 106041029) has the molecular formula C13H32N4O2S and a molecular weight of 308.49 g/mol. Its IUPAC name is 1-[2-[di(propan-2-yl)amino]ethylsulfamoyl-methylamino]-3-(methylamino)propane.
| Compound Name | 1-[2-[di(propan-2-yl)amino]ethylsulfamoyl-methylamino]-3-(methylamino)propane |
|---|---|
| PubChem CID | 106041029 |
| Molecular Formula | C13H32N4O2S |
| Molecular Weight | 308.49 g/mol |
| Exact Mass | 308.22 |
| IUPAC Name | 1-[2-[di(propan-2-yl)amino]ethylsulfamoyl-methylamino]-3-(methylamino)propane |
| SMILES | CNCCCN(C)S(=O)(=O)NCCN(C(C)C)C(C)C |
| InChI | InChI=1S/C13H32N4O2S/c1-12(2)17(13(3)4)11-9-15-20(18,19)16(6)10-7-8-14-5/h12-15H,7-11H2,1-6H3 |
| InChIKey | NHEMKEUGDGPFTE-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.49 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|