C11H26N4O2S2 — CID 106327431
4-[2-[[methyl-[3-(methylamino)propyl]sulfamoyl]amino]ethyl]thiomorpholine (PubChem CID 106327431) has the molecular formula C11H26N4O2S2 and a molecular weight of 310.49 g/mol. Its IUPAC name is 4-[2-[[methyl-[3-(methylamino)propyl]sulfamoyl]amino]ethyl]thiomorpholine.
| Compound Name | 4-[2-[[methyl-[3-(methylamino)propyl]sulfamoyl]amino]ethyl]thiomorpholine |
|---|---|
| PubChem CID | 106327431 |
| Molecular Formula | C11H26N4O2S2 |
| Molecular Weight | 310.49 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 4-[2-[[methyl-[3-(methylamino)propyl]sulfamoyl]amino]ethyl]thiomorpholine |
| SMILES | CNCCCN(C)S(=O)(=O)NCCN1CCSCC1 |
| InChI | InChI=1S/C11H26N4O2S2/c1-12-4-3-6-14(2)19(16,17)13-5-7-15-8-10-18-11-9-15/h12-13H,3-11H2,1-2H3 |
| InChIKey | LVPPYPJKMFGZGX-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.49 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|