C9H19N5O2S — CID 106077027
3-(methylamino)-N-[3-(triazol-1-yl)propyl]propane-1-sulfonamide (PubChem CID 106077027) has the molecular formula C9H19N5O2S and a molecular weight of 261.35 g/mol. Its IUPAC name is 3-(methylamino)-N-[3-(triazol-1-yl)propyl]propane-1-sulfonamide.
| Compound Name | 3-(methylamino)-N-[3-(triazol-1-yl)propyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 106077027 |
| Molecular Formula | C9H19N5O2S |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 3-(methylamino)-N-[3-(triazol-1-yl)propyl]propane-1-sulfonamide |
| SMILES | CNCCCS(=O)(=O)NCCCn1ccnn1 |
| InChI | InChI=1S/C9H19N5O2S/c1-10-4-3-9-17(15,16)12-5-2-7-14-8-6-11-13-14/h6,8,10,12H,2-5,7,9H2,1H3 |
| InChIKey | LESZMTIJRVOLLF-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|