C12H24N4O2S — CID 106054419
N-(4-imidazol-1-ylbutyl)-4-(methylamino)butane-1-sulfonamide (PubChem CID 106054419) has the molecular formula C12H24N4O2S and a molecular weight of 288.42 g/mol. Its IUPAC name is N-(4-imidazol-1-ylbutyl)-4-(methylamino)butane-1-sulfonamide.
| Compound Name | N-(4-imidazol-1-ylbutyl)-4-(methylamino)butane-1-sulfonamide |
|---|---|
| PubChem CID | 106054419 |
| Molecular Formula | C12H24N4O2S |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | N-(4-imidazol-1-ylbutyl)-4-(methylamino)butane-1-sulfonamide |
| SMILES | CNCCCCS(=O)(=O)NCCCCn1ccnc1 |
| InChI | InChI=1S/C12H24N4O2S/c1-13-6-3-5-11-19(17,18)15-7-2-4-9-16-10-8-14-12-16/h8,10,12-13,15H,2-7,9,11H2,1H3 |
| InChIKey | NCQXGFLBKLGIKC-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|