C7H14N2O7S2 — CID 175825454
4-imidazol-1-ylbutane-1-sulfonic acid;sulfuric acid (PubChem CID 175825454) has the molecular formula C7H14N2O7S2 and a molecular weight of 302.33 g/mol. Its IUPAC name is 4-imidazol-1-ylbutane-1-sulfonic acid;sulfuric acid.
| Compound Name | 4-imidazol-1-ylbutane-1-sulfonic acid;sulfuric acid |
|---|---|
| PubChem CID | 175825454 |
| Molecular Formula | C7H14N2O7S2 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.02 |
| IUPAC Name | 4-imidazol-1-ylbutane-1-sulfonic acid;sulfuric acid |
| SMILES | O=S(=O)(O)CCCCn1ccnc1.O=S(=O)(O)O |
| InChI | InChI=1S/C7H12N2O3S.H2O4S/c10-13(11,12)6-2-1-4-9-5-3-8-7-9;1-5(2,3)4/h3,5,7H,1-2,4,6H2,(H,10,11,12);(H2,1,2,3,4) |
| InChIKey | LIZPXWQKMYJSAO-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 146.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|