C12H22N4O4S — CID 86038795
bis(1-propylimidazole);sulfuric acid (PubChem CID 86038795) has the molecular formula C12H22N4O4S and a molecular weight of 318.40 g/mol. Its IUPAC name is bis(1-propylimidazole);sulfuric acid.
| Compound Name | bis(1-propylimidazole);sulfuric acid |
|---|---|
| PubChem CID | 86038795 |
| Molecular Formula | C12H22N4O4S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | bis(1-propylimidazole);sulfuric acid |
| SMILES | CCCn1ccnc1.CCCn1ccnc1.O=S(=O)(O)O |
| InChI | InChI=1S/2C6H10N2.H2O4S/c2*1-2-4-8-5-3-7-6-8;1-5(2,3)4/h2*3,5-6H,2,4H2,1H3;(H2,1,2,3,4) |
| InChIKey | HSGDISQFVFNHRW-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|