C18H28N2O3S — CID 175477505
4-methylbenzenesulfonic acid;1-octylimidazole (PubChem CID 175477505) has the molecular formula C18H28N2O3S and a molecular weight of 352.50 g/mol. Its IUPAC name is 4-methylbenzenesulfonic acid;1-octylimidazole.
| Compound Name | 4-methylbenzenesulfonic acid;1-octylimidazole |
|---|---|
| PubChem CID | 175477505 |
| Molecular Formula | C18H28N2O3S |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 4-methylbenzenesulfonic acid;1-octylimidazole |
| SMILES | CCCCCCCCn1ccnc1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C11H20N2.C7H8O3S/c1-2-3-4-5-6-7-9-13-10-8-12-11-13;1-6-2-4-7(5-3-6)11(8,9)10/h8,10-11H,2-7,9H2,1H3;2-5H,1H3,(H,8,9,10) |
| InChIKey | OIYGXTUCGBMQCK-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|