C21H36N2O3S — CID 174906160
1-decyl-3-methyl-2H-imidazole;4-methylbenzenesulfonic acid (PubChem CID 174906160) has the molecular formula C21H36N2O3S and a molecular weight of 396.60 g/mol. Its IUPAC name is 1-decyl-3-methyl-2H-imidazole;4-methylbenzenesulfonic acid.
| Compound Name | 1-decyl-3-methyl-2H-imidazole;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 174906160 |
| Molecular Formula | C21H36N2O3S |
| Molecular Weight | 396.60 g/mol |
| Exact Mass | 396.24 |
| IUPAC Name | 1-decyl-3-methyl-2H-imidazole;4-methylbenzenesulfonic acid |
| SMILES | CCCCCCCCCCN1C=CN(C)C1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C14H28N2.C7H8O3S/c1-3-4-5-6-7-8-9-10-11-16-13-12-15(2)14-16;1-6-2-4-7(5-3-6)11(8,9)10/h12-13H,3-11,14H2,1-2H3;2-5H,1H3,(H,8,9,10) |
| InChIKey | AFNBRRUUJFOYRU-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.60 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|