About 1-methyl-3-octyl-2H-imidazole;pyridine-2-carboxylic acid
1-methyl-3-octyl-2H-imidazole;pyridine-2-carboxylic acid (PubChem CID 157351994) has the molecular formula C18H29N3O2
and a molecular weight of 319.45 g/mol. Its IUPAC name is 1-methyl-3-octyl-2H-imidazole;pyridine-2-carboxylic acid.
Molecular Properties
| Compound Name | 1-methyl-3-octyl-2H-imidazole;pyridine-2-carboxylic acid |
| PubChem CID | 157351994 |
| Molecular Formula | C18H29N3O2 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.23 |
| IUPAC Name | 1-methyl-3-octyl-2H-imidazole;pyridine-2-carboxylic acid |
| SMILES | CCCCCCCCN1C=CN(C)C1.O=C(O)c1ccccn1 |
| InChI | InChI=1S/C12H24N2.C6H5NO2/c1-3-4-5-6-7-8-9-14-11-10-13(2)12-14;8-6(9)5-3-1-2-4-7-5/h10-11H,3-9,12H2,1-2H3;1-4H,(H,8,9) |
| InChIKey | BHQLBAAATCMIBU-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-3-octyl-2H-imidazole;pyridine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-octyl-2H-imidazole;pyridine-2-carboxylic acid?
The IUPAC name of 1-methyl-3-octyl-2H-imidazole;pyridine-2-carboxylic acid (CID 157351994) is 1-methyl-3-octyl-2H-imidazole;pyridine-2-carboxylic acid.
What is the SMILES notation for 1-methyl-3-octyl-2H-imidazole;pyridine-2-carboxylic acid?
The canonical SMILES for 1-methyl-3-octyl-2H-imidazole;pyridine-2-carboxylic acid is CCCCCCCCN1C=CN(C)C1.O=C(O)c1ccccn1.
What is the InChIKey of 1-methyl-3-octyl-2H-imidazole;pyridine-2-carboxylic acid?
The InChIKey is BHQLBAAATCMIBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2.C6H5NO2/c1-3-4-5-6-7-8-9-14-11-10-13(2)12-14;8-6(9)5-3-1-2-4-7-5/h10-11H,3-9,12H2,1-2H3;1-4H,(H,8,9).
What are the key properties of 1-methyl-3-octyl-2H-imidazole;pyridine-2-carboxylic acid?
1-methyl-3-octyl-2H-imidazole;pyridine-2-carboxylic acid has a molecular weight of 319.45 g/mol, XLogP of 3.80, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-octyl-2H-imidazole;pyridine-2-carboxylic acid is sourced from PubChem (CID 157351994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).