C16H22N2O4 — CID 175355843
1-butyl-3-methyl-2H-imidazole;phthalic acid (PubChem CID 175355843) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is 1-butyl-3-methyl-2H-imidazole;phthalic acid.
| Compound Name | 1-butyl-3-methyl-2H-imidazole;phthalic acid |
|---|---|
| PubChem CID | 175355843 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 1-butyl-3-methyl-2H-imidazole;phthalic acid |
| SMILES | CCCCN1C=CN(C)C1.O=C(O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C8H16N2.C8H6O4/c1-3-4-5-10-7-6-9(2)8-10;9-7(10)5-3-1-2-4-6(5)8(11)12/h6-7H,3-5,8H2,1-2H3;1-4H,(H,9,10)(H,11,12) |
| InChIKey | BMVGGXJRFZBEFR-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |