C13H18N2O2 — CID 171377191
benzoic acid;1-ethyl-3-methyl-2H-imidazole (PubChem CID 171377191) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is benzoic acid;1-ethyl-3-methyl-2H-imidazole.
| Compound Name | benzoic acid;1-ethyl-3-methyl-2H-imidazole |
|---|---|
| PubChem CID | 171377191 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | benzoic acid;1-ethyl-3-methyl-2H-imidazole |
| SMILES | CCN1C=CN(C)C1.O=C(O)c1ccccc1 |
| InChI | InChI=1S/C7H6O2.C6H12N2/c8-7(9)6-4-2-1-3-5-6;1-3-8-5-4-7(2)6-8/h1-5H,(H,8,9);4-5H,3,6H2,1-2H3 |
| InChIKey | ADSJGMIRAPETOP-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |