C7H13N2O2- — CID 162292973
1-ethyl-3-methyl-2H-imidazole formate (PubChem CID 162292973) has the molecular formula C7H13N2O2- and a molecular weight of 157.19 g/mol. Its IUPAC name is 1-ethyl-3-methyl-2H-imidazole formate.
| Compound Name | 1-ethyl-3-methyl-2H-imidazole formate |
|---|---|
| PubChem CID | 162292973 |
| Molecular Formula | C7H13N2O2- |
| Molecular Weight | 157.19 g/mol |
| Exact Mass | 157.10 |
| IUPAC Name | 1-ethyl-3-methyl-2H-imidazole formate |
| SMILES | CCN1C=CN(C)C1.O=C[O-] |
| InChI | InChI=1S/C6H12N2.CH2O2/c1-3-8-5-4-7(2)6-8;2-1-3/h4-5H,3,6H2,1-2H3;1H,(H,2,3)/p-1 |
| InChIKey | RCAIAWXCDYJARE-UHFFFAOYSA-M |
| XLogP | -0.95 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.19 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|