About potassium;1-ethyl-3-methyl-2H-imidazole;hexafluorophosphate
potassium;1-ethyl-3-methyl-2H-imidazole;hexafluorophosphate (PubChem CID 174903378) has the molecular formula C6H12F6KN2P
and a molecular weight of 296.24 g/mol. Its IUPAC name is potassium;1-ethyl-3-methyl-2H-imidazole;hexafluorophosphate.
Molecular Properties
| Compound Name | potassium;1-ethyl-3-methyl-2H-imidazole;hexafluorophosphate |
| PubChem CID | 174903378 |
| Molecular Formula | C6H12F6KN2P |
| Molecular Weight | 296.24 g/mol |
| Exact Mass | 296.03 |
| IUPAC Name | potassium;1-ethyl-3-methyl-2H-imidazole;hexafluorophosphate |
| SMILES | CCN1C=CN(C)C1.F[P-](F)(F)(F)(F)F.[K+] |
| InChI | InChI=1S/C6H12N2.F6P.K/c1-3-8-5-4-7(2)6-8;1-7(2,3,4,5)6;/h4-5H,3,6H2,1-2H3;;/q;-1;+1 |
| InChIKey | CHNYCVNBIIOKIX-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.24 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze potassium;1-ethyl-3-methyl-2H-imidazole;hexafluorophosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;1-ethyl-3-methyl-2H-imidazole;hexafluorophosphate?
The IUPAC name of potassium;1-ethyl-3-methyl-2H-imidazole;hexafluorophosphate (CID 174903378) is potassium;1-ethyl-3-methyl-2H-imidazole;hexafluorophosphate.
What is the SMILES notation for potassium;1-ethyl-3-methyl-2H-imidazole;hexafluorophosphate?
The canonical SMILES for potassium;1-ethyl-3-methyl-2H-imidazole;hexafluorophosphate is CCN1C=CN(C)C1.F[P-](F)(F)(F)(F)F.[K+].
What is the InChIKey of potassium;1-ethyl-3-methyl-2H-imidazole;hexafluorophosphate?
The InChIKey is CHNYCVNBIIOKIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2.F6P.K/c1-3-8-5-4-7(2)6-8;1-7(2,3,4,5)6;/h4-5H,3,6H2,1-2H3;;/q;-1;+1.
What are the key properties of potassium;1-ethyl-3-methyl-2H-imidazole;hexafluorophosphate?
potassium;1-ethyl-3-methyl-2H-imidazole;hexafluorophosphate has a molecular weight of 296.24 g/mol, XLogP of 1.07, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;1-ethyl-3-methyl-2H-imidazole;hexafluorophosphate is sourced from PubChem (CID 174903378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).