About difluoroazanide;1-ethyl-3-methyl-2H-imidazole;bis(sulfur dioxide)
difluoroazanide;1-ethyl-3-methyl-2H-imidazole;bis(sulfur dioxide) (PubChem CID 160727359) has the molecular formula C6H12F2N3O4S2-
and a molecular weight of 292.31 g/mol. Its IUPAC name is difluoroazanide;1-ethyl-3-methyl-2H-imidazole;bis(sulfur dioxide).
Molecular Properties
| Compound Name | difluoroazanide;1-ethyl-3-methyl-2H-imidazole;bis(sulfur dioxide) |
| PubChem CID | 160727359 |
| Molecular Formula | C6H12F2N3O4S2- |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.02 |
| IUPAC Name | difluoroazanide;1-ethyl-3-methyl-2H-imidazole;bis(sulfur dioxide) |
| SMILES | CCN1C=CN(C)C1.F[N-]F.O=S=O.O=S=O |
| InChI | InChI=1S/C6H12N2.F2N.2O2S/c1-3-8-5-4-7(2)6-8;3*1-3-2/h4-5H,3,6H2,1-2H3;;;/q;-1;; |
| InChIKey | RTWRCFOOPGAEGB-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 88.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze difluoroazanide;1-ethyl-3-methyl-2H-imidazole;bis(sulfur dioxide) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of difluoroazanide;1-ethyl-3-methyl-2H-imidazole;bis(sulfur dioxide)?
The IUPAC name of difluoroazanide;1-ethyl-3-methyl-2H-imidazole;bis(sulfur dioxide) (CID 160727359) is difluoroazanide;1-ethyl-3-methyl-2H-imidazole;bis(sulfur dioxide).
What is the SMILES notation for difluoroazanide;1-ethyl-3-methyl-2H-imidazole;bis(sulfur dioxide)?
The canonical SMILES for difluoroazanide;1-ethyl-3-methyl-2H-imidazole;bis(sulfur dioxide) is CCN1C=CN(C)C1.F[N-]F.O=S=O.O=S=O.
What is the InChIKey of difluoroazanide;1-ethyl-3-methyl-2H-imidazole;bis(sulfur dioxide)?
The InChIKey is RTWRCFOOPGAEGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2.F2N.2O2S/c1-3-8-5-4-7(2)6-8;3*1-3-2/h4-5H,3,6H2,1-2H3;;;/q;-1;;.
What are the key properties of difluoroazanide;1-ethyl-3-methyl-2H-imidazole;bis(sulfur dioxide)?
difluoroazanide;1-ethyl-3-methyl-2H-imidazole;bis(sulfur dioxide) has a molecular weight of 292.31 g/mol, XLogP of 0.47, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for difluoroazanide;1-ethyl-3-methyl-2H-imidazole;bis(sulfur dioxide) is sourced from PubChem (CID 160727359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).