About cobalt;1-ethyl-3-methyl-2H-imidazole;methanone
cobalt;1-ethyl-3-methyl-2H-imidazole;methanone (PubChem CID 174605686) has the molecular formula C10H16CoN2O4-4
and a molecular weight of 287.18 g/mol. Its IUPAC name is cobalt;1-ethyl-3-methyl-2H-imidazole;methanone.
Molecular Properties
| Compound Name | cobalt;1-ethyl-3-methyl-2H-imidazole;methanone |
| PubChem CID | 174605686 |
| Molecular Formula | C10H16CoN2O4-4 |
| Molecular Weight | 287.18 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | cobalt;1-ethyl-3-methyl-2H-imidazole;methanone |
| SMILES | CCN1C=CN(C)C1.[CH-]=O.[CH-]=O.[CH-]=O.[CH-]=O.[Co] |
| InChI | InChI=1S/C6H12N2.4CHO.Co/c1-3-8-5-4-7(2)6-8;4*1-2;/h4-5H,3,6H2,1-2H3;4*1H;/q;4*-1; |
| InChIKey | ULXFQEITORANPH-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.18 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze cobalt;1-ethyl-3-methyl-2H-imidazole;methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cobalt;1-ethyl-3-methyl-2H-imidazole;methanone?
The IUPAC name of cobalt;1-ethyl-3-methyl-2H-imidazole;methanone (CID 174605686) is cobalt;1-ethyl-3-methyl-2H-imidazole;methanone.
What is the SMILES notation for cobalt;1-ethyl-3-methyl-2H-imidazole;methanone?
The canonical SMILES for cobalt;1-ethyl-3-methyl-2H-imidazole;methanone is CCN1C=CN(C)C1.[CH-]=O.[CH-]=O.[CH-]=O.[CH-]=O.[Co].
What is the InChIKey of cobalt;1-ethyl-3-methyl-2H-imidazole;methanone?
The InChIKey is ULXFQEITORANPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2.4CHO.Co/c1-3-8-5-4-7(2)6-8;4*1-2;/h4-5H,3,6H2,1-2H3;4*1H;/q;4*-1;.
What are the key properties of cobalt;1-ethyl-3-methyl-2H-imidazole;methanone?
cobalt;1-ethyl-3-methyl-2H-imidazole;methanone has a molecular weight of 287.18 g/mol, XLogP of -0.42, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt;1-ethyl-3-methyl-2H-imidazole;methanone is sourced from PubChem (CID 174605686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).