About azanium;1-ethyl-3-methyl-2H-imidazole;tetrafluoroborate
azanium;1-ethyl-3-methyl-2H-imidazole;tetrafluoroborate (PubChem CID 174106655) has the molecular formula C6H16BF4N3
and a molecular weight of 217.02 g/mol. Its IUPAC name is azanium;1-ethyl-3-methyl-2H-imidazole;tetrafluoroborate.
Molecular Properties
| Compound Name | azanium;1-ethyl-3-methyl-2H-imidazole;tetrafluoroborate |
| PubChem CID | 174106655 |
| Molecular Formula | C6H16BF4N3 |
| Molecular Weight | 217.02 g/mol |
| Exact Mass | 217.14 |
| IUPAC Name | azanium;1-ethyl-3-methyl-2H-imidazole;tetrafluoroborate |
| SMILES | CCN1C=CN(C)C1.F[B-](F)(F)F.[NH4+] |
| InChI | InChI=1S/C6H12N2.BF4.H3N/c1-3-8-5-4-7(2)6-8;2-1(3,4)5;/h4-5H,3,6H2,1-2H3;;1H3/q;-1;/p+1 |
| InChIKey | ANMXGAHRSUHEPZ-UHFFFAOYSA-O |
| XLogP | 2.36 |
| TPSA | 42.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.02 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze azanium;1-ethyl-3-methyl-2H-imidazole;tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanium;1-ethyl-3-methyl-2H-imidazole;tetrafluoroborate?
The IUPAC name of azanium;1-ethyl-3-methyl-2H-imidazole;tetrafluoroborate (CID 174106655) is azanium;1-ethyl-3-methyl-2H-imidazole;tetrafluoroborate.
What is the SMILES notation for azanium;1-ethyl-3-methyl-2H-imidazole;tetrafluoroborate?
The canonical SMILES for azanium;1-ethyl-3-methyl-2H-imidazole;tetrafluoroborate is CCN1C=CN(C)C1.F[B-](F)(F)F.[NH4+].
What is the InChIKey of azanium;1-ethyl-3-methyl-2H-imidazole;tetrafluoroborate?
The InChIKey is ANMXGAHRSUHEPZ-UHFFFAOYSA-O. The full InChI is InChI=1S/C6H12N2.BF4.H3N/c1-3-8-5-4-7(2)6-8;2-1(3,4)5;/h4-5H,3,6H2,1-2H3;;1H3/q;-1;/p+1.
What are the key properties of azanium;1-ethyl-3-methyl-2H-imidazole;tetrafluoroborate?
azanium;1-ethyl-3-methyl-2H-imidazole;tetrafluoroborate has a molecular weight of 217.02 g/mol, XLogP of 2.36, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azanium;1-ethyl-3-methyl-2H-imidazole;tetrafluoroborate is sourced from PubChem (CID 174106655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).