C6H15N2O4P — CID 135221908
1-ethyl-3-methyl-2H-imidazole;phosphoric acid (PubChem CID 135221908) has the molecular formula C6H15N2O4P and a molecular weight of 210.17 g/mol. Its IUPAC name is 1-ethyl-3-methyl-2H-imidazole;phosphoric acid.
| Compound Name | 1-ethyl-3-methyl-2H-imidazole;phosphoric acid |
|---|---|
| PubChem CID | 135221908 |
| Molecular Formula | C6H15N2O4P |
| Molecular Weight | 210.17 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 1-ethyl-3-methyl-2H-imidazole;phosphoric acid |
| SMILES | CCN1C=CN(C)C1.O=P(O)(O)O |
| InChI | InChI=1S/C6H12N2.H3O4P/c1-3-8-5-4-7(2)6-8;1-5(2,3)4/h4-5H,3,6H2,1-2H3;(H3,1,2,3,4) |
| InChIKey | NNSZTUMGONXXNP-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.17 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|