About acetic acid;1-ethyl-3-methyl-2H-imidazole;hydrochloride
acetic acid;1-ethyl-3-methyl-2H-imidazole;hydrochloride (PubChem CID 172844057) has the molecular formula C8H17ClN2O2
and a molecular weight of 208.69 g/mol. Its IUPAC name is acetic acid;1-ethyl-3-methyl-2H-imidazole;hydrochloride.
Molecular Properties
| Compound Name | acetic acid;1-ethyl-3-methyl-2H-imidazole;hydrochloride |
| PubChem CID | 172844057 |
| Molecular Formula | C8H17ClN2O2 |
| Molecular Weight | 208.69 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | acetic acid;1-ethyl-3-methyl-2H-imidazole;hydrochloride |
| SMILES | CC(=O)O.CCN1C=CN(C)C1.Cl |
| InChI | InChI=1S/C6H12N2.C2H4O2.ClH/c1-3-8-5-4-7(2)6-8;1-2(3)4;/h4-5H,3,6H2,1-2H3;1H3,(H,3,4);1H |
| InChIKey | XEHYLVKMOHZKEL-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.69 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze acetic acid;1-ethyl-3-methyl-2H-imidazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;1-ethyl-3-methyl-2H-imidazole;hydrochloride?
The IUPAC name of acetic acid;1-ethyl-3-methyl-2H-imidazole;hydrochloride (CID 172844057) is acetic acid;1-ethyl-3-methyl-2H-imidazole;hydrochloride.
What is the SMILES notation for acetic acid;1-ethyl-3-methyl-2H-imidazole;hydrochloride?
The canonical SMILES for acetic acid;1-ethyl-3-methyl-2H-imidazole;hydrochloride is CC(=O)O.CCN1C=CN(C)C1.Cl.
What is the InChIKey of acetic acid;1-ethyl-3-methyl-2H-imidazole;hydrochloride?
The InChIKey is XEHYLVKMOHZKEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2.C2H4O2.ClH/c1-3-8-5-4-7(2)6-8;1-2(3)4;/h4-5H,3,6H2,1-2H3;1H3,(H,3,4);1H.
What are the key properties of acetic acid;1-ethyl-3-methyl-2H-imidazole;hydrochloride?
acetic acid;1-ethyl-3-methyl-2H-imidazole;hydrochloride has a molecular weight of 208.69 g/mol, XLogP of 1.20, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;1-ethyl-3-methyl-2H-imidazole;hydrochloride is sourced from PubChem (CID 172844057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).