acetic acid;1-butyl-3-ethyl-2H-imidazole

C11H22N2O2 — CID 175549883

IUPACacetic acid;1-butyl-3-ethyl-2H-imidazole
SMILESCC(=O)O.CCCCN1C=CN(CC)C1
InChIInChI=1S/C9H18N2.C2H4O2/c1-3-5-6-11-8-7-10(4-2)9-11;1-2(3)4/h7-8H,3-6,9H2,1-2H3;1H3,(H,3,4)
InChIKeyCXYVCEOKDOXIBI-UHFFFAOYSA-N
MW214.31 g/mol
LogP1.94
Rot. Bonds4

About acetic acid;1-butyl-3-ethyl-2H-imidazole

acetic acid;1-butyl-3-ethyl-2H-imidazole (PubChem CID 175549883) has the molecular formula C11H22N2O2 and a molecular weight of 214.31 g/mol. Its IUPAC name is acetic acid;1-butyl-3-ethyl-2H-imidazole.

Molecular Properties

Compound Nameacetic acid;1-butyl-3-ethyl-2H-imidazole
PubChem CID175549883
Molecular FormulaC11H22N2O2
Molecular Weight214.31 g/mol
Exact Mass214.17
IUPAC Nameacetic acid;1-butyl-3-ethyl-2H-imidazole
SMILESCC(=O)O.CCCCN1C=CN(CC)C1
InChIInChI=1S/C9H18N2.C2H4O2/c1-3-5-6-11-8-7-10(4-2)9-11;1-2(3)4/h7-8H,3-6,9H2,1-2H3;1H3,(H,3,4)
InChIKeyCXYVCEOKDOXIBI-UHFFFAOYSA-N
XLogP1.94
TPSA43.78 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500214.31
LogP ≤ 51.94
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze acetic acid;1-butyl-3-ethyl-2H-imidazole with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of acetic acid;1-butyl-3-ethyl-2H-imidazole?
The IUPAC name of acetic acid;1-butyl-3-ethyl-2H-imidazole (CID 175549883) is acetic acid;1-butyl-3-ethyl-2H-imidazole.
What is the SMILES notation for acetic acid;1-butyl-3-ethyl-2H-imidazole?
The canonical SMILES for acetic acid;1-butyl-3-ethyl-2H-imidazole is CC(=O)O.CCCCN1C=CN(CC)C1.
What is the InChIKey of acetic acid;1-butyl-3-ethyl-2H-imidazole?
The InChIKey is CXYVCEOKDOXIBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2.C2H4O2/c1-3-5-6-11-8-7-10(4-2)9-11;1-2(3)4/h7-8H,3-6,9H2,1-2H3;1H3,(H,3,4).
What are the key properties of acetic acid;1-butyl-3-ethyl-2H-imidazole?
acetic acid;1-butyl-3-ethyl-2H-imidazole has a molecular weight of 214.31 g/mol, XLogP of 1.94, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;1-butyl-3-ethyl-2H-imidazole is sourced from PubChem (CID 175549883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).