C8H16F4N2S — CID 175320698
1-ethyl-3-methyl-2H-imidazole;sulfane;1,1,2,2-tetrafluoroethane (PubChem CID 175320698) has the molecular formula C8H16F4N2S and a molecular weight of 248.29 g/mol. Its IUPAC name is 1-ethyl-3-methyl-2H-imidazole;sulfane;1,1,2,2-tetrafluoroethane.
| Compound Name | 1-ethyl-3-methyl-2H-imidazole;sulfane;1,1,2,2-tetrafluoroethane |
|---|---|
| PubChem CID | 175320698 |
| Molecular Formula | C8H16F4N2S |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 1-ethyl-3-methyl-2H-imidazole;sulfane;1,1,2,2-tetrafluoroethane |
| SMILES | CCN1C=CN(C)C1.FC(F)C(F)F.S |
| InChI | InChI=1S/C6H12N2.C2H2F4.H2S/c1-3-8-5-4-7(2)6-8;3-1(4)2(5)6;/h4-5H,3,6H2,1-2H3;1-2H;1H2 |
| InChIKey | YZKPJUYWVBLQCP-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|