C5H10F6N2P- — CID 158907533
1,3-dimethyl-2H-imidazole hexafluorophosphate (PubChem CID 158907533) has the molecular formula C5H10F6N2P- and a molecular weight of 243.11 g/mol. Its IUPAC name is 1,3-dimethyl-2H-imidazole hexafluorophosphate.
| Compound Name | 1,3-dimethyl-2H-imidazole hexafluorophosphate |
|---|---|
| PubChem CID | 158907533 |
| Molecular Formula | C5H10F6N2P- |
| Molecular Weight | 243.11 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | 1,3-dimethyl-2H-imidazole hexafluorophosphate |
| SMILES | CN1C=CN(C)C1.F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C5H10N2.F6P/c1-6-3-4-7(2)5-6;1-7(2,3,4,5)6/h3-4H,5H2,1-2H3;/q;-1 |
| InChIKey | JGFRSJLSFOAHAK-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.11 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|