About 1-(difluoromethyl)-3-methyl-2H-imidazole;hydrobromide;hydrochloride
1-(difluoromethyl)-3-methyl-2H-imidazole;hydrobromide;hydrochloride (PubChem CID 175693926) has the molecular formula C5H10BrClF2N2
and a molecular weight of 251.50 g/mol. Its IUPAC name is 1-(difluoromethyl)-3-methyl-2H-imidazole;hydrobromide;hydrochloride.
Molecular Properties
| Compound Name | 1-(difluoromethyl)-3-methyl-2H-imidazole;hydrobromide;hydrochloride |
| PubChem CID | 175693926 |
| Molecular Formula | C5H10BrClF2N2 |
| Molecular Weight | 251.50 g/mol |
| Exact Mass | 249.97 |
| IUPAC Name | 1-(difluoromethyl)-3-methyl-2H-imidazole;hydrobromide;hydrochloride |
| SMILES | Br.CN1C=CN(C(F)F)C1.Cl |
| InChI | InChI=1S/C5H8F2N2.BrH.ClH/c1-8-2-3-9(4-8)5(6)7;;/h2-3,5H,4H2,1H3;2*1H |
| InChIKey | RQFZGBSPFPPBRM-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.50 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-(difluoromethyl)-3-methyl-2H-imidazole;hydrobromide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(difluoromethyl)-3-methyl-2H-imidazole;hydrobromide;hydrochloride?
The IUPAC name of 1-(difluoromethyl)-3-methyl-2H-imidazole;hydrobromide;hydrochloride (CID 175693926) is 1-(difluoromethyl)-3-methyl-2H-imidazole;hydrobromide;hydrochloride.
What is the SMILES notation for 1-(difluoromethyl)-3-methyl-2H-imidazole;hydrobromide;hydrochloride?
The canonical SMILES for 1-(difluoromethyl)-3-methyl-2H-imidazole;hydrobromide;hydrochloride is Br.CN1C=CN(C(F)F)C1.Cl.
What is the InChIKey of 1-(difluoromethyl)-3-methyl-2H-imidazole;hydrobromide;hydrochloride?
The InChIKey is RQFZGBSPFPPBRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8F2N2.BrH.ClH/c1-8-2-3-9(4-8)5(6)7;;/h2-3,5H,4H2,1H3;2*1H.
What are the key properties of 1-(difluoromethyl)-3-methyl-2H-imidazole;hydrobromide;hydrochloride?
1-(difluoromethyl)-3-methyl-2H-imidazole;hydrobromide;hydrochloride has a molecular weight of 251.50 g/mol, XLogP of 1.88, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(difluoromethyl)-3-methyl-2H-imidazole;hydrobromide;hydrochloride is sourced from PubChem (CID 175693926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).