About 1-methyl-3-(1,2,2-trifluoroethyl)-2H-imidazole
1-methyl-3-(1,2,2-trifluoroethyl)-2H-imidazole (PubChem CID 175549515) has the molecular formula C6H9F3N2
and a molecular weight of 166.15 g/mol. Its IUPAC name is 1-methyl-3-(1,2,2-trifluoroethyl)-2H-imidazole.
Molecular Properties
| Compound Name | 1-methyl-3-(1,2,2-trifluoroethyl)-2H-imidazole |
| PubChem CID | 175549515 |
| Molecular Formula | C6H9F3N2 |
| Molecular Weight | 166.15 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | 1-methyl-3-(1,2,2-trifluoroethyl)-2H-imidazole |
| SMILES | CN1C=CN(C(F)C(F)F)C1 |
| InChI | InChI=1S/C6H9F3N2/c1-10-2-3-11(4-10)6(9)5(7)8/h2-3,5-6H,4H2,1H3 |
| InChIKey | JULAYRIPHOPKLM-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.15 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-3-(1,2,2-trifluoroethyl)-2H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-(1,2,2-trifluoroethyl)-2H-imidazole?
The IUPAC name of 1-methyl-3-(1,2,2-trifluoroethyl)-2H-imidazole (CID 175549515) is 1-methyl-3-(1,2,2-trifluoroethyl)-2H-imidazole.
What is the SMILES notation for 1-methyl-3-(1,2,2-trifluoroethyl)-2H-imidazole?
The canonical SMILES for 1-methyl-3-(1,2,2-trifluoroethyl)-2H-imidazole is CN1C=CN(C(F)C(F)F)C1.
What is the InChIKey of 1-methyl-3-(1,2,2-trifluoroethyl)-2H-imidazole?
The InChIKey is JULAYRIPHOPKLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9F3N2/c1-10-2-3-11(4-10)6(9)5(7)8/h2-3,5-6H,4H2,1H3.
What are the key properties of 1-methyl-3-(1,2,2-trifluoroethyl)-2H-imidazole?
1-methyl-3-(1,2,2-trifluoroethyl)-2H-imidazole has a molecular weight of 166.15 g/mol, XLogP of 1.22, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-(1,2,2-trifluoroethyl)-2H-imidazole is sourced from PubChem (CID 175549515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).