C11H18Br2N4 — CID 175095291
1-[1,1-dibromo-1-(3-methyl-2H-imidazol-1-yl)propan-2-yl]-3-methyl-2H-imidazole (PubChem CID 175095291) has the molecular formula C11H18Br2N4 and a molecular weight of 366.10 g/mol. Its IUPAC name is 1-[1,1-dibromo-1-(3-methyl-2H-imidazol-1-yl)propan-2-yl]-3-methyl-2H-imidazole.
| Compound Name | 1-[1,1-dibromo-1-(3-methyl-2H-imidazol-1-yl)propan-2-yl]-3-methyl-2H-imidazole |
|---|---|
| PubChem CID | 175095291 |
| Molecular Formula | C11H18Br2N4 |
| Molecular Weight | 366.10 g/mol |
| Exact Mass | 363.99 |
| IUPAC Name | 1-[1,1-dibromo-1-(3-methyl-2H-imidazol-1-yl)propan-2-yl]-3-methyl-2H-imidazole |
| SMILES | CC(N1C=CN(C)C1)C(Br)(Br)N1C=CN(C)C1 |
| InChI | InChI=1S/C11H18Br2N4/c1-10(16-6-4-14(2)8-16)11(12,13)17-7-5-15(3)9-17/h4-7,10H,8-9H2,1-3H3 |
| InChIKey | RAWRYXYXJXZUPI-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.10 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|