C16H26N4O6 — CID 174589905
bis[1-(3-methyl-2H-imidazol-1-yl)ethyl] 2,3-dihydroxybutanedioate (PubChem CID 174589905) has the molecular formula C16H26N4O6 and a molecular weight of 370.41 g/mol. Its IUPAC name is bis[1-(3-methyl-2H-imidazol-1-yl)ethyl] 2,3-dihydroxybutanedioate.
| Compound Name | bis[1-(3-methyl-2H-imidazol-1-yl)ethyl] 2,3-dihydroxybutanedioate |
|---|---|
| PubChem CID | 174589905 |
| Molecular Formula | C16H26N4O6 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | bis[1-(3-methyl-2H-imidazol-1-yl)ethyl] 2,3-dihydroxybutanedioate |
| SMILES | CC(OC(=O)C(O)C(O)C(=O)OC(C)N1C=CN(C)C1)N1C=CN(C)C1 |
| InChI | InChI=1S/C16H26N4O6/c1-11(19-7-5-17(3)9-19)25-15(23)13(21)14(22)16(24)26-12(2)20-8-6-18(4)10-20/h5-8,11-14,21-22H,9-10H2,1-4H3 |
| InChIKey | CRARVYSPWUAKFU-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 106.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |