About 1,3-dimethyl-2H-imidazole;methyl dihydrogen phosphite
1,3-dimethyl-2H-imidazole;methyl dihydrogen phosphite (PubChem CID 175432447) has the molecular formula C6H15N2O3P
and a molecular weight of 194.17 g/mol. Its IUPAC name is 1,3-dimethyl-2H-imidazole;methyl dihydrogen phosphite.
Molecular Properties
| Compound Name | 1,3-dimethyl-2H-imidazole;methyl dihydrogen phosphite |
| PubChem CID | 175432447 |
| Molecular Formula | C6H15N2O3P |
| Molecular Weight | 194.17 g/mol |
| Exact Mass | 194.08 |
| IUPAC Name | 1,3-dimethyl-2H-imidazole;methyl dihydrogen phosphite |
| SMILES | CN1C=CN(C)C1.COP(O)O |
| InChI | InChI=1S/C5H10N2.CH5O3P/c1-6-3-4-7(2)5-6;1-4-5(2)3/h3-4H,5H2,1-2H3;2-3H,1H3 |
| InChIKey | GIFNMYFOQKSIIE-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 56.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.17 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dimethyl-2H-imidazole;methyl dihydrogen phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyl-2H-imidazole;methyl dihydrogen phosphite?
The IUPAC name of 1,3-dimethyl-2H-imidazole;methyl dihydrogen phosphite (CID 175432447) is 1,3-dimethyl-2H-imidazole;methyl dihydrogen phosphite.
What is the SMILES notation for 1,3-dimethyl-2H-imidazole;methyl dihydrogen phosphite?
The canonical SMILES for 1,3-dimethyl-2H-imidazole;methyl dihydrogen phosphite is CN1C=CN(C)C1.COP(O)O.
What is the InChIKey of 1,3-dimethyl-2H-imidazole;methyl dihydrogen phosphite?
The InChIKey is GIFNMYFOQKSIIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2.CH5O3P/c1-6-3-4-7(2)5-6;1-4-5(2)3/h3-4H,5H2,1-2H3;2-3H,1H3.
What are the key properties of 1,3-dimethyl-2H-imidazole;methyl dihydrogen phosphite?
1,3-dimethyl-2H-imidazole;methyl dihydrogen phosphite has a molecular weight of 194.17 g/mol, XLogP of 0.14, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-2H-imidazole;methyl dihydrogen phosphite is sourced from PubChem (CID 175432447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).