C23H38N2O3 — CID 175228795
3-(hydroxymethyl)benzoic acid;1-methyl-3-undecyl-2H-imidazole (PubChem CID 175228795) has the molecular formula C23H38N2O3 and a molecular weight of 390.57 g/mol. Its IUPAC name is 3-(hydroxymethyl)benzoic acid;1-methyl-3-undecyl-2H-imidazole.
| Compound Name | 3-(hydroxymethyl)benzoic acid;1-methyl-3-undecyl-2H-imidazole |
|---|---|
| PubChem CID | 175228795 |
| Molecular Formula | C23H38N2O3 |
| Molecular Weight | 390.57 g/mol |
| Exact Mass | 390.29 |
| IUPAC Name | 3-(hydroxymethyl)benzoic acid;1-methyl-3-undecyl-2H-imidazole |
| SMILES | CCCCCCCCCCCN1C=CN(C)C1.O=C(O)c1cccc(CO)c1 |
| InChI | InChI=1S/C15H30N2.C8H8O3/c1-3-4-5-6-7-8-9-10-11-12-17-14-13-16(2)15-17;9-5-6-2-1-3-7(4-6)8(10)11/h13-14H,3-12,15H2,1-2H3;1-4,9H,5H2,(H,10,11) |
| InChIKey | LYKIFYKBEKVACT-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.57 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|