C23H42N2O4 — CID 175228786
formic acid;furan-2-ylmethanol;1-methyl-3-tridecyl-2H-imidazole (PubChem CID 175228786) has the molecular formula C23H42N2O4 and a molecular weight of 410.60 g/mol. Its IUPAC name is formic acid;furan-2-ylmethanol;1-methyl-3-tridecyl-2H-imidazole.
| Compound Name | formic acid;furan-2-ylmethanol;1-methyl-3-tridecyl-2H-imidazole |
|---|---|
| PubChem CID | 175228786 |
| Molecular Formula | C23H42N2O4 |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.31 |
| IUPAC Name | formic acid;furan-2-ylmethanol;1-methyl-3-tridecyl-2H-imidazole |
| SMILES | CCCCCCCCCCCCCN1C=CN(C)C1.O=CO.OCc1ccco1 |
| InChI | InChI=1S/C17H34N2.C5H6O2.CH2O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-19-16-15-18(2)17-19;6-4-5-2-1-3-7-5;2-1-3/h15-16H,3-14,17H2,1-2H3;1-3,6H,4H2;1H,(H,2,3) |
| InChIKey | LXSRFGCCKXJKIU-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|