About 1-butyl-3-methyl-2H-imidazole;formic acid;furan
1-butyl-3-methyl-2H-imidazole;formic acid;furan (PubChem CID 175545923) has the molecular formula C13H22N2O3
and a molecular weight of 254.33 g/mol. Its IUPAC name is 1-butyl-3-methyl-2H-imidazole;formic acid;furan.
Molecular Properties
| Compound Name | 1-butyl-3-methyl-2H-imidazole;formic acid;furan |
| PubChem CID | 175545923 |
| Molecular Formula | C13H22N2O3 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | 1-butyl-3-methyl-2H-imidazole;formic acid;furan |
| SMILES | CCCCN1C=CN(C)C1.O=CO.c1ccoc1 |
| InChI | InChI=1S/C8H16N2.C4H4O.CH2O2/c1-3-4-5-10-7-6-9(2)8-10;1-2-4-5-3-1;2-1-3/h6-7H,3-5,8H2,1-2H3;1-4H;1H,(H,2,3) |
| InChIKey | VFBSEJBFVJQMCW-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-3-methyl-2H-imidazole;formic acid;furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-3-methyl-2H-imidazole;formic acid;furan?
The IUPAC name of 1-butyl-3-methyl-2H-imidazole;formic acid;furan (CID 175545923) is 1-butyl-3-methyl-2H-imidazole;formic acid;furan.
What is the SMILES notation for 1-butyl-3-methyl-2H-imidazole;formic acid;furan?
The canonical SMILES for 1-butyl-3-methyl-2H-imidazole;formic acid;furan is CCCCN1C=CN(C)C1.O=CO.c1ccoc1.
What is the InChIKey of 1-butyl-3-methyl-2H-imidazole;formic acid;furan?
The InChIKey is VFBSEJBFVJQMCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2.C4H4O.CH2O2/c1-3-4-5-10-7-6-9(2)8-10;1-2-4-5-3-1;2-1-3/h6-7H,3-5,8H2,1-2H3;1-4H;1H,(H,2,3).
What are the key properties of 1-butyl-3-methyl-2H-imidazole;formic acid;furan?
1-butyl-3-methyl-2H-imidazole;formic acid;furan has a molecular weight of 254.33 g/mol, XLogP of 2.44, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-3-methyl-2H-imidazole;formic acid;furan is sourced from PubChem (CID 175545923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).