C18H30N2O4 — CID 175229006
formic acid;furan-2-yl-(3-methyl-1-octyl-2H-imidazol-4-yl)methanol (PubChem CID 175229006) has the molecular formula C18H30N2O4 and a molecular weight of 338.45 g/mol. Its IUPAC name is formic acid;furan-2-yl-(3-methyl-1-octyl-2H-imidazol-4-yl)methanol.
| Compound Name | formic acid;furan-2-yl-(3-methyl-1-octyl-2H-imidazol-4-yl)methanol |
|---|---|
| PubChem CID | 175229006 |
| Molecular Formula | C18H30N2O4 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | formic acid;furan-2-yl-(3-methyl-1-octyl-2H-imidazol-4-yl)methanol |
| SMILES | CCCCCCCCN1C=C(C(O)c2ccco2)N(C)C1.O=CO |
| InChI | InChI=1S/C17H28N2O2.CH2O2/c1-3-4-5-6-7-8-11-19-13-15(18(2)14-19)17(20)16-10-9-12-21-16;2-1-3/h9-10,12-13,17,20H,3-8,11,14H2,1-2H3;1H,(H,2,3) |
| InChIKey | PSAKGSXJFBCXNO-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|