About 2-(furan-2-yl)tridecanal
2-(furan-2-yl)tridecanal (PubChem CID 175449616) has the molecular formula C17H28O2
and a molecular weight of 264.41 g/mol. Its IUPAC name is 2-(furan-2-yl)tridecanal.
Molecular Properties
| Compound Name | 2-(furan-2-yl)tridecanal |
| PubChem CID | 175449616 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | 2-(furan-2-yl)tridecanal |
| SMILES | CCCCCCCCCCCC(C=O)c1ccco1 |
| InChI | InChI=1S/C17H28O2/c1-2-3-4-5-6-7-8-9-10-12-16(15-18)17-13-11-14-19-17/h11,13-16H,2-10,12H2,1H3 |
| InChIKey | YZOXFHHNUOTNET-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(furan-2-yl)tridecanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(furan-2-yl)tridecanal?
The IUPAC name of 2-(furan-2-yl)tridecanal (CID 175449616) is 2-(furan-2-yl)tridecanal.
What is the SMILES notation for 2-(furan-2-yl)tridecanal?
The canonical SMILES for 2-(furan-2-yl)tridecanal is CCCCCCCCCCCC(C=O)c1ccco1.
What is the InChIKey of 2-(furan-2-yl)tridecanal?
The InChIKey is YZOXFHHNUOTNET-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28O2/c1-2-3-4-5-6-7-8-9-10-12-16(15-18)17-13-11-14-19-17/h11,13-16H,2-10,12H2,1H3.
What are the key properties of 2-(furan-2-yl)tridecanal?
2-(furan-2-yl)tridecanal has a molecular weight of 264.41 g/mol, XLogP of 5.48, 12 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(furan-2-yl)tridecanal is sourced from PubChem (CID 175449616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).