C24H29O2P — CID 122375580
2-[(2R)-1-diphenylphosphoryloctan-2-yl]furan (PubChem CID 122375580) has the molecular formula C24H29O2P and a molecular weight of 380.47 g/mol. Its IUPAC name is 2-[(2R)-1-diphenylphosphoryloctan-2-yl]furan.
| Compound Name | 2-[(2R)-1-diphenylphosphoryloctan-2-yl]furan |
|---|---|
| PubChem CID | 122375580 |
| Molecular Formula | C24H29O2P |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | 2-[(2R)-1-diphenylphosphoryloctan-2-yl]furan |
| SMILES | CCCCCC[C@@H](CP(=O)(c1ccccc1)c1ccccc1)c1ccco1 |
| InChI | InChI=1S/C24H29O2P/c1-2-3-4-7-13-21(24-18-12-19-26-24)20-27(25,22-14-8-5-9-15-22)23-16-10-6-11-17-23/h5-6,8-12,14-19,21H,2-4,7,13,20H2,1H3/t21-/m0/s1 |
| InChIKey | AGOMPLKNTVNSBY-NRFANRHFSA-N |
| XLogP | 6.35 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|