C30H46BO3P — CID 122375570
2-[(2R)-1-diphenylphosphoryldodecan-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 122375570) has the molecular formula C30H46BO3P and a molecular weight of 496.48 g/mol. Its IUPAC name is 2-[(2R)-1-diphenylphosphoryldodecan-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[(2R)-1-diphenylphosphoryldodecan-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 122375570 |
| Molecular Formula | C30H46BO3P |
| Molecular Weight | 496.48 g/mol |
| Exact Mass | 496.33 |
| IUPAC Name | 2-[(2R)-1-diphenylphosphoryldodecan-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CCCCCCCCCC[C@H](CP(=O)(c1ccccc1)c1ccccc1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C30H46BO3P/c1-6-7-8-9-10-11-12-15-20-26(31-33-29(2,3)30(4,5)34-31)25-35(32,27-21-16-13-17-22-27)28-23-18-14-19-24-28/h13-14,16-19,21-24,26H,6-12,15,20,25H2,1-5H3/t26-/m1/s1 |
| InChIKey | FVMMNDMPWTXSGT-AREMUKBSSA-N |
| XLogP | 7.99 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.48 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|