C19H32BNO2 — CID 25149879
N-benzyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexan-1-amine (PubChem CID 25149879) has the molecular formula C19H32BNO2 and a molecular weight of 317.28 g/mol. Its IUPAC name is N-benzyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexan-1-amine.
| Compound Name | N-benzyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexan-1-amine |
|---|---|
| PubChem CID | 25149879 |
| Molecular Formula | C19H32BNO2 |
| Molecular Weight | 317.28 g/mol |
| Exact Mass | 317.25 |
| IUPAC Name | N-benzyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexan-1-amine |
| SMILES | CCC(CCCNCc1ccccc1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C19H32BNO2/c1-6-17(20-22-18(2,3)19(4,5)23-20)13-10-14-21-15-16-11-8-7-9-12-16/h7-9,11-12,17,21H,6,10,13-15H2,1-5H3 |
| InChIKey | FUEUDXFWGGYCAO-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.28 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|