C21H33BO4 — CID 164681739
benzyl (3R)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)octanoate (PubChem CID 164681739) has the molecular formula C21H33BO4 and a molecular weight of 360.30 g/mol. Its IUPAC name is benzyl (3R)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)octanoate.
| Compound Name | benzyl (3R)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)octanoate |
|---|---|
| PubChem CID | 164681739 |
| Molecular Formula | C21H33BO4 |
| Molecular Weight | 360.30 g/mol |
| Exact Mass | 360.25 |
| IUPAC Name | benzyl (3R)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)octanoate |
| SMILES | CCCCC[C@H](CC(=O)OCc1ccccc1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C21H33BO4/c1-6-7-9-14-18(22-25-20(2,3)21(4,5)26-22)15-19(23)24-16-17-12-10-8-11-13-17/h8,10-13,18H,6-7,9,14-16H2,1-5H3/t18-/m1/s1 |
| InChIKey | BQXKKOALENLTKH-GOSISDBHSA-N |
| XLogP | 5.16 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.30 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|