C19H29BO4 — CID 164681250
benzyl (4R)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanoate (PubChem CID 164681250) has the molecular formula C19H29BO4 and a molecular weight of 332.25 g/mol. Its IUPAC name is benzyl (4R)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanoate.
| Compound Name | benzyl (4R)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanoate |
|---|---|
| PubChem CID | 164681250 |
| Molecular Formula | C19H29BO4 |
| Molecular Weight | 332.25 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | benzyl (4R)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanoate |
| SMILES | CC[C@H](CCC(=O)OCc1ccccc1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C19H29BO4/c1-6-16(20-23-18(2,3)19(4,5)24-20)12-13-17(21)22-14-15-10-8-7-9-11-15/h7-11,16H,6,12-14H2,1-5H3/t16-/m1/s1 |
| InChIKey | WPKUTMFAAOZXFO-MRXNPFEDSA-N |
| XLogP | 4.38 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.25 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|