C25H34BO5P — CID 122375576
[(3R)-4-diphenylphosphoryl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl] propanoate (PubChem CID 122375576) has the molecular formula C25H34BO5P and a molecular weight of 456.33 g/mol. Its IUPAC name is [(3R)-4-diphenylphosphoryl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl] propanoate.
| Compound Name | [(3R)-4-diphenylphosphoryl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl] propanoate |
|---|---|
| PubChem CID | 122375576 |
| Molecular Formula | C25H34BO5P |
| Molecular Weight | 456.33 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | [(3R)-4-diphenylphosphoryl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl] propanoate |
| SMILES | CCC(=O)OCC[C@H](CP(=O)(c1ccccc1)c1ccccc1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C25H34BO5P/c1-6-23(27)29-18-17-20(26-30-24(2,3)25(4,5)31-26)19-32(28,21-13-9-7-10-14-21)22-15-11-8-12-16-22/h7-16,20H,6,17-19H2,1-5H3/t20-/m1/s1 |
| InChIKey | PRUHWLHCGSTNKF-HXUWFJFHSA-N |
| XLogP | 4.81 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.33 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|