C28H37BCl2O5 — CID 154585591
[(4S)-8-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)octyl] 2-(2,4-dichlorophenoxy)acetate (PubChem CID 154585591) has the molecular formula C28H37BCl2O5 and a molecular weight of 535.32 g/mol. Its IUPAC name is [(4S)-8-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)octyl] 2-(2,4-dichlorophenoxy)acetate.
| Compound Name | [(4S)-8-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)octyl] 2-(2,4-dichlorophenoxy)acetate |
|---|---|
| PubChem CID | 154585591 |
| Molecular Formula | C28H37BCl2O5 |
| Molecular Weight | 535.32 g/mol |
| Exact Mass | 534.21 |
| IUPAC Name | [(4S)-8-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)octyl] 2-(2,4-dichlorophenoxy)acetate |
| SMILES | CC1(C)OB([C@@H](CCCCc2ccccc2)CCCOC(=O)COc2ccc(Cl)cc2Cl)OC1(C)C |
| InChI | InChI=1S/C28H37BCl2O5/c1-27(2)28(3,4)36-29(35-27)22(14-9-8-13-21-11-6-5-7-12-21)15-10-18-33-26(32)20-34-25-17-16-23(30)19-24(25)31/h5-7,11-12,16-17,19,22H,8-10,13-15,18,20H2,1-4H3/t22-/m0/s1 |
| InChIKey | NVLDNKNIZYTJFU-QFIPXVFZSA-N |
| XLogP | 7.57 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.32 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|